C15H19Cl2N3O — CID 107185109
(5-amino-2,3-dichlorophenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone (PubChem CID 107185109) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is (5-amino-2,3-dichlorophenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone.
| Compound Name | (5-amino-2,3-dichlorophenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 107185109 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (5-amino-2,3-dichlorophenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone |
| SMILES | Nc1cc(Cl)c(Cl)c(C(=O)N2CCC(N3CCCC3)C2)c1 |
| InChI | InChI=1S/C15H19Cl2N3O/c16-13-8-10(18)7-12(14(13)17)15(21)20-6-3-11(9-20)19-4-1-2-5-19/h7-8,11H,1-6,9,18H2 |
| InChIKey | RGRDGRZOKVHIQB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|