C11H12Cl2N2O3 — CID 107210976
(5-amino-2,3-dichlorophenyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone (PubChem CID 107210976) has the molecular formula C11H12Cl2N2O3 and a molecular weight of 291.13 g/mol. Its IUPAC name is (5-amino-2,3-dichlorophenyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone.
| Compound Name | (5-amino-2,3-dichlorophenyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 107210976 |
| Molecular Formula | C11H12Cl2N2O3 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | (5-amino-2,3-dichlorophenyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone |
| SMILES | Nc1cc(Cl)c(Cl)c(C(=O)N2C[C@@H](O)[C@@H](O)C2)c1 |
| InChI | InChI=1S/C11H12Cl2N2O3/c12-7-2-5(14)1-6(10(7)13)11(18)15-3-8(16)9(17)4-15/h1-2,8-9,16-17H,3-4,14H2/t8-,9+ |
| InChIKey | QRABMDGVGBPDMW-DTORHVGOSA-N |
| XLogP | 0.75 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|