C10H10Cl2N2O3 — CID 106668644
(2,5-dichloro-4-pyridinyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone (PubChem CID 106668644) has the molecular formula C10H10Cl2N2O3 and a molecular weight of 277.11 g/mol. Its IUPAC name is (2,5-dichloro-4-pyridinyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone.
| Compound Name | (2,5-dichloro-4-pyridinyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 106668644 |
| Molecular Formula | C10H10Cl2N2O3 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | (2,5-dichloro-4-pyridinyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cc(Cl)ncc1Cl)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H10Cl2N2O3/c11-6-2-13-9(12)1-5(6)10(17)14-3-7(15)8(16)4-14/h1-2,7-8,15-16H,3-4H2 |
| InChIKey | HVAMXDHQTIMHDK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|