About (2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone
(2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone (PubChem CID 103857585) has the molecular formula C10H11ClN2O3
and a molecular weight of 242.66 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | (2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone |
| PubChem CID | 103857585 |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccnc(Cl)c1)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H11ClN2O3/c11-9-3-6(1-2-12-9)10(16)13-4-7(14)8(15)5-13/h1-3,7-8,14-15H,4-5H2/t7-,8+ |
| InChIKey | ADCIIUOFSBMIHF-OCAPTIKFSA-N |
| XLogP | -0.09 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone?
The IUPAC name of (2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone (CID 103857585) is (2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone.
What is the SMILES notation for (2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone?
The canonical SMILES for (2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone is O=C(c1ccnc(Cl)c1)N1C[C@@H](O)[C@@H](O)C1.
What is the InChIKey of (2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone?
The InChIKey is ADCIIUOFSBMIHF-OCAPTIKFSA-N. The full InChI is InChI=1S/C10H11ClN2O3/c11-9-3-6(1-2-12-9)10(16)13-4-7(14)8(15)5-13/h1-3,7-8,14-15H,4-5H2/t7-,8+.
What are the key properties of (2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone?
(2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone has a molecular weight of 242.66 g/mol, XLogP of -0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-pyridinyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone is sourced from PubChem (CID 103857585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).