C13H15ClN2O4 — CID 107526554
2-[1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]oxyacetic acid (PubChem CID 107526554) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is 2-[1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]oxyacetic acid.
| Compound Name | 2-[1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 107526554 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]oxyacetic acid |
| SMILES | O=C(O)COC1CCN(C(=O)c2ccnc(Cl)c2)CC1 |
| InChI | InChI=1S/C13H15ClN2O4/c14-11-7-9(1-4-15-11)13(19)16-5-2-10(3-6-16)20-8-12(17)18/h1,4,7,10H,2-3,5-6,8H2,(H,17,18) |
| InChIKey | CIKOBTLVWIGPKL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|