C14H18ClN3O2 — CID 47124151
1-(2-chloropyridine-4-carbonyl)-N,N-dimethylpiperidine-4-carboxamide (PubChem CID 47124151) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 1-(2-chloropyridine-4-carbonyl)-N,N-dimethylpiperidine-4-carboxamide.
| Compound Name | 1-(2-chloropyridine-4-carbonyl)-N,N-dimethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 47124151 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-(2-chloropyridine-4-carbonyl)-N,N-dimethylpiperidine-4-carboxamide |
| SMILES | CN(C)C(=O)C1CCN(C(=O)c2ccnc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H18ClN3O2/c1-17(2)13(19)10-4-7-18(8-5-10)14(20)11-3-6-16-12(15)9-11/h3,6,9-10H,4-5,7-8H2,1-2H3 |
| InChIKey | DIQLIWMRXNXQJI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|