C14H17Cl2N3O2 — CID 60637345
1-(5,6-dichloropyridine-3-carbonyl)-N,N-dimethylpiperidine-4-carboxamide (PubChem CID 60637345) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.22 g/mol. Its IUPAC name is 1-(5,6-dichloropyridine-3-carbonyl)-N,N-dimethylpiperidine-4-carboxamide.
| Compound Name | 1-(5,6-dichloropyridine-3-carbonyl)-N,N-dimethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 60637345 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 1-(5,6-dichloropyridine-3-carbonyl)-N,N-dimethylpiperidine-4-carboxamide |
| SMILES | CN(C)C(=O)C1CCN(C(=O)c2cnc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H17Cl2N3O2/c1-18(2)13(20)9-3-5-19(6-4-9)14(21)10-7-11(15)12(16)17-8-10/h7-9H,3-6H2,1-2H3 |
| InChIKey | DWVARNJIGIRBTE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|