C12H13Cl2N3O2 — CID 43079586
1-(5,6-dichloropyridine-3-carbonyl)piperidine-3-carboxamide (PubChem CID 43079586) has the molecular formula C12H13Cl2N3O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is 1-(5,6-dichloropyridine-3-carbonyl)piperidine-3-carboxamide.
| Compound Name | 1-(5,6-dichloropyridine-3-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43079586 |
| Molecular Formula | C12H13Cl2N3O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 1-(5,6-dichloropyridine-3-carbonyl)piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(C(=O)c2cnc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H13Cl2N3O2/c13-9-4-8(5-16-10(9)14)12(19)17-3-1-2-7(6-17)11(15)18/h4-5,7H,1-3,6H2,(H2,15,18) |
| InChIKey | YFLURLZRVCYXNG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|