C18H19ClN4O2 — CID 125436986
(3R)-1-[4-(6-amino-5-chloro-3-pyridinyl)benzoyl]piperidine-3-carboxamide (PubChem CID 125436986) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is (3R)-1-[4-(6-amino-5-chloro-3-pyridinyl)benzoyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[4-(6-amino-5-chloro-3-pyridinyl)benzoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125436986 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (3R)-1-[4-(6-amino-5-chloro-3-pyridinyl)benzoyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN(C(=O)c2ccc(-c3cnc(N)c(Cl)c3)cc2)C1 |
| InChI | InChI=1S/C18H19ClN4O2/c19-15-8-14(9-22-16(15)20)11-3-5-12(6-4-11)18(25)23-7-1-2-13(10-23)17(21)24/h3-6,8-9,13H,1-2,7,10H2,(H2,20,22)(H2,21,24)/t13-/m1/s1 |
| InChIKey | OGYLQEGVMABLKP-CYBMUJFWSA-N |
| XLogP | 2.32 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |