C16H15Cl2N3O2S — CID 60600926
1-[2-(3,4-dichlorophenyl)-1,3-thiazole-4-carbonyl]piperidine-3-carboxamide (PubChem CID 60600926) has the molecular formula C16H15Cl2N3O2S and a molecular weight of 384.29 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenyl)-1,3-thiazole-4-carbonyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-(3,4-dichlorophenyl)-1,3-thiazole-4-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 60600926 |
| Molecular Formula | C16H15Cl2N3O2S |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 1-[2-(3,4-dichlorophenyl)-1,3-thiazole-4-carbonyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(C(=O)c2csc(-c3ccc(Cl)c(Cl)c3)n2)C1 |
| InChI | InChI=1S/C16H15Cl2N3O2S/c17-11-4-3-9(6-12(11)18)15-20-13(8-24-15)16(23)21-5-1-2-10(7-21)14(19)22/h3-4,6,8,10H,1-2,5,7H2,(H2,19,22) |
| InChIKey | RXAXDGJFBRDLDF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |