C16H18N2OS — CID 17474442
[2-(4-methylphenyl)-1,3-thiazol-4-yl]-piperidin-1-ylmethanone (PubChem CID 17474442) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is [2-(4-methylphenyl)-1,3-thiazol-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 17474442 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]-piperidin-1-ylmethanone |
| SMILES | Cc1ccc(-c2nc(C(=O)N3CCCCC3)cs2)cc1 |
| InChI | InChI=1S/C16H18N2OS/c1-12-5-7-13(8-6-12)15-17-14(11-20-15)16(19)18-9-3-2-4-10-18/h5-8,11H,2-4,9-10H2,1H3 |
| InChIKey | UGTPPKIFZLNJHI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |