C16H15N3O5S — CID 119167916
1-[2-(4-nitrophenyl)-1,3-thiazole-4-carbonyl]piperidine-3-carboxylic acid (PubChem CID 119167916) has the molecular formula C16H15N3O5S and a molecular weight of 361.38 g/mol. Its IUPAC name is 1-[2-(4-nitrophenyl)-1,3-thiazole-4-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-(4-nitrophenyl)-1,3-thiazole-4-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119167916 |
| Molecular Formula | C16H15N3O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 1-[2-(4-nitrophenyl)-1,3-thiazole-4-carbonyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)c2csc(-c3ccc([N+](=O)[O-])cc3)n2)C1 |
| InChI | InChI=1S/C16H15N3O5S/c20-15(18-7-1-2-11(8-18)16(21)22)13-9-25-14(17-13)10-3-5-12(6-4-10)19(23)24/h3-6,9,11H,1-2,7-8H2,(H,21,22) |
| InChIKey | KWLUSZYRZYDDKO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|