About (3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone
(3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone (PubChem CID 119579002) has the molecular formula C15H16N4O3S
and a molecular weight of 332.39 g/mol. Its IUPAC name is (3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone.
Molecular Properties
| Compound Name | (3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone |
| PubChem CID | 119579002 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone |
| SMILES | CC1CN(C(=O)c2csc(-c3ccc([N+](=O)[O-])cc3)n2)CCN1 |
| InChI | InChI=1S/C15H16N4O3S/c1-10-8-18(7-6-16-10)15(20)13-9-23-14(17-13)11-2-4-12(5-3-11)19(21)22/h2-5,9-10,16H,6-8H2,1H3 |
| InChIKey | DNSZOXSFYWEJKR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone?
The IUPAC name of (3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone (CID 119579002) is (3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone.
What is the SMILES notation for (3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone?
The canonical SMILES for (3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone is CC1CN(C(=O)c2csc(-c3ccc([N+](=O)[O-])cc3)n2)CCN1.
What is the InChIKey of (3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone?
The InChIKey is DNSZOXSFYWEJKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O3S/c1-10-8-18(7-6-16-10)15(20)13-9-23-14(17-13)11-2-4-12(5-3-11)19(21)22/h2-5,9-10,16H,6-8H2,1H3.
What are the key properties of (3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone?
(3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone has a molecular weight of 332.39 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylpiperazin-1-yl)-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone is sourced from PubChem (CID 119579002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).