C17H21ClN4O3S — CID 119397277
[3-(methylaminomethyl)piperidin-1-yl]-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone;hydrochloride (PubChem CID 119397277) has the molecular formula C17H21ClN4O3S and a molecular weight of 396.90 g/mol. Its IUPAC name is [3-(methylaminomethyl)piperidin-1-yl]-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone;hydrochloride.
| Compound Name | [3-(methylaminomethyl)piperidin-1-yl]-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119397277 |
| Molecular Formula | C17H21ClN4O3S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | [3-(methylaminomethyl)piperidin-1-yl]-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone;hydrochloride |
| SMILES | CNCC1CCCN(C(=O)c2csc(-c3ccc([N+](=O)[O-])cc3)n2)C1.Cl |
| InChI | InChI=1S/C17H20N4O3S.ClH/c1-18-9-12-3-2-8-20(10-12)17(22)15-11-25-16(19-15)13-4-6-14(7-5-13)21(23)24;/h4-7,11-12,18H,2-3,8-10H2,1H3;1H |
| InChIKey | DBCNYIIVQZSRBW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|