C17H20N4O3S — CID 119595181
[3-(1-aminoethyl)piperidin-1-yl]-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone (PubChem CID 119595181) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is [3-(1-aminoethyl)piperidin-1-yl]-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone.
| Compound Name | [3-(1-aminoethyl)piperidin-1-yl]-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 119595181 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [3-(1-aminoethyl)piperidin-1-yl]-[2-(4-nitrophenyl)-1,3-thiazol-4-yl]methanone |
| SMILES | CC(N)C1CCCN(C(=O)c2csc(-c3ccc([N+](=O)[O-])cc3)n2)C1 |
| InChI | InChI=1S/C17H20N4O3S/c1-11(18)13-3-2-8-20(9-13)17(22)15-10-25-16(19-15)12-4-6-14(7-5-12)21(23)24/h4-7,10-11,13H,2-3,8-9,18H2,1H3 |
| InChIKey | KGEHGJGEYKRDNX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|