C15H13N3O5S — CID 119364879
(2S)-1-[2-(4-nitrophenyl)-1,3-thiazole-4-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 119364879) has the molecular formula C15H13N3O5S and a molecular weight of 347.35 g/mol. Its IUPAC name is (2S)-1-[2-(4-nitrophenyl)-1,3-thiazole-4-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-(4-nitrophenyl)-1,3-thiazole-4-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119364879 |
| Molecular Formula | C15H13N3O5S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (2S)-1-[2-(4-nitrophenyl)-1,3-thiazole-4-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)c1csc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C15H13N3O5S/c19-14(17-7-1-2-12(17)15(20)21)11-8-24-13(16-11)9-3-5-10(6-4-9)18(22)23/h3-6,8,12H,1-2,7H2,(H,20,21)/t12-/m0/s1 |
| InChIKey | ZGLNUINSYJPAFN-LBPRGKRZSA-N |
| XLogP | 2.41 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|