C18H20N4O3 — CID 126446549
(3S)-1-[4-(6-methoxypyridazin-3-yl)benzoyl]piperidine-3-carboxamide (PubChem CID 126446549) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is (3S)-1-[4-(6-methoxypyridazin-3-yl)benzoyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[4-(6-methoxypyridazin-3-yl)benzoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 126446549 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (3S)-1-[4-(6-methoxypyridazin-3-yl)benzoyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(-c2ccc(C(=O)N3CCC[C@H](C(N)=O)C3)cc2)nn1 |
| InChI | InChI=1S/C18H20N4O3/c1-25-16-9-8-15(20-21-16)12-4-6-13(7-5-12)18(24)22-10-2-3-14(11-22)17(19)23/h4-9,14H,2-3,10-11H2,1H3,(H2,19,23)/t14-/m0/s1 |
| InChIKey | JTWKXARYCQNMPJ-AWEZNQCLSA-N |
| XLogP | 1.49 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |