C11H11BrClNO3 — CID 107989730
(3-bromo-4-chlorophenyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone (PubChem CID 107989730) has the molecular formula C11H11BrClNO3 and a molecular weight of 320.57 g/mol. Its IUPAC name is (3-bromo-4-chlorophenyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone.
| Compound Name | (3-bromo-4-chlorophenyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 107989730 |
| Molecular Formula | C11H11BrClNO3 |
| Molecular Weight | 320.57 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | (3-bromo-4-chlorophenyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccc(Cl)c(Br)c1)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C11H11BrClNO3/c12-7-3-6(1-2-8(7)13)11(17)14-4-9(15)10(16)5-14/h1-3,9-10,15-16H,4-5H2 |
| InChIKey | DDIMYNAVUQAFGL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.57 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |