C11H13BrN2O3 — CID 107220786
(4-amino-3-bromophenyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone (PubChem CID 107220786) has the molecular formula C11H13BrN2O3 and a molecular weight of 301.14 g/mol. Its IUPAC name is (4-amino-3-bromophenyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone.
| Compound Name | (4-amino-3-bromophenyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 107220786 |
| Molecular Formula | C11H13BrN2O3 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | (4-amino-3-bromophenyl)-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methanone |
| SMILES | Nc1ccc(C(=O)N2C[C@@H](O)[C@@H](O)C2)cc1Br |
| InChI | InChI=1S/C11H13BrN2O3/c12-7-3-6(1-2-8(7)13)11(17)14-4-9(15)10(16)5-14/h1-3,9-10,15-16H,4-5,13H2/t9-,10+ |
| InChIKey | JEGLOZVLHQMHPP-AOOOYVTPSA-N |
| XLogP | 0.21 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|