C12H13F3N2O3 — CID 106673725
[4-amino-3-(trifluoromethyl)phenyl]-(3,4-dihydroxypyrrolidin-1-yl)methanone (PubChem CID 106673725) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is [4-amino-3-(trifluoromethyl)phenyl]-(3,4-dihydroxypyrrolidin-1-yl)methanone.
| Compound Name | [4-amino-3-(trifluoromethyl)phenyl]-(3,4-dihydroxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 106673725 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [4-amino-3-(trifluoromethyl)phenyl]-(3,4-dihydroxypyrrolidin-1-yl)methanone |
| SMILES | Nc1ccc(C(=O)N2CC(O)C(O)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O3/c13-12(14,15)7-3-6(1-2-8(7)16)11(20)17-4-9(18)10(19)5-17/h1-3,9-10,18-19H,4-5,16H2 |
| InChIKey | ZAQFABPPVZGZHX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|