C11H13N3O5 — CID 106673724
(4-amino-3-nitrophenyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone (PubChem CID 106673724) has the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. Its IUPAC name is (4-amino-3-nitrophenyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone.
| Compound Name | (4-amino-3-nitrophenyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 106673724 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (4-amino-3-nitrophenyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
| SMILES | Nc1ccc(C(=O)N2CC(O)C(O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O5/c12-7-2-1-6(3-8(7)14(18)19)11(17)13-4-9(15)10(16)5-13/h1-3,9-10,15-16H,4-5,12H2 |
| InChIKey | UKWVGFCRAWEQSQ-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|