C14H17BrN2O — CID 115558697
3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-(3-amino-4-bromophenyl)methanone (PubChem CID 115558697) has the molecular formula C14H17BrN2O and a molecular weight of 309.21 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-(3-amino-4-bromophenyl)methanone.
| Compound Name | 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-(3-amino-4-bromophenyl)methanone |
|---|---|
| PubChem CID | 115558697 |
| Molecular Formula | C14H17BrN2O |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-(3-amino-4-bromophenyl)methanone |
| SMILES | Nc1cc(C(=O)N2CC3CCCC3C2)ccc1Br |
| InChI | InChI=1S/C14H17BrN2O/c15-12-5-4-9(6-13(12)16)14(18)17-7-10-2-1-3-11(10)8-17/h4-6,10-11H,1-3,7-8,16H2 |
| InChIKey | PDIXQGRODPPGJC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|