C13H17BrN2O2 — CID 61092791
(3-amino-4-bromophenyl)-[4-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 61092791) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. Its IUPAC name is (3-amino-4-bromophenyl)-[4-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | (3-amino-4-bromophenyl)-[4-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 61092791 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | (3-amino-4-bromophenyl)-[4-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | Nc1cc(C(=O)N2CCC(CO)CC2)ccc1Br |
| InChI | InChI=1S/C13H17BrN2O2/c14-11-2-1-10(7-12(11)15)13(18)16-5-3-9(8-17)4-6-16/h1-2,7,9,17H,3-6,8,15H2 |
| InChIKey | FDRMUJXBPZJSIX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|