C14H18BrN3O — CID 166390716
[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-amino-6-bromo-3-pyridinyl)methanone (PubChem CID 166390716) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is [(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-amino-6-bromo-3-pyridinyl)methanone.
| Compound Name | [(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-amino-6-bromo-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 166390716 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | [(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-amino-6-bromo-3-pyridinyl)methanone |
| SMILES | Nc1cc(C(=O)N2C[C@H]3CCCC[C@H]3C2)cnc1Br |
| InChI | InChI=1S/C14H18BrN3O/c15-13-12(16)5-11(6-17-13)14(19)18-7-9-3-1-2-4-10(9)8-18/h5-6,9-10H,1-4,7-8,16H2/t9-,10+ |
| InChIKey | KSFYFJJFCLYYDZ-AOOOYVTPSA-N |
| XLogP | 2.69 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|