C15H21ClN4O — CID 62236710
3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(5-chloro-6-hydrazinyl-3-pyridinyl)methanone (PubChem CID 62236710) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(5-chloro-6-hydrazinyl-3-pyridinyl)methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(5-chloro-6-hydrazinyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 62236710 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(5-chloro-6-hydrazinyl-3-pyridinyl)methanone |
| SMILES | NNc1ncc(C(=O)N2CCC3CCCCC3C2)cc1Cl |
| InChI | InChI=1S/C15H21ClN4O/c16-13-7-12(8-18-14(13)19-17)15(21)20-6-5-10-3-1-2-4-11(10)9-20/h7-8,10-11H,1-6,9,17H2,(H,18,19) |
| InChIKey | DXJUZDRZQQVCLQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|