C17H21Cl2NO2 — CID 9225736
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3,5-dichloro-4-methoxyphenyl)methanone (PubChem CID 9225736) has the molecular formula C17H21Cl2NO2 and a molecular weight of 342.27 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3,5-dichloro-4-methoxyphenyl)methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3,5-dichloro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 9225736 |
| Molecular Formula | C17H21Cl2NO2 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3,5-dichloro-4-methoxyphenyl)methanone |
| SMILES | COc1c(Cl)cc(C(=O)N2CC[C@@H]3CCCC[C@H]3C2)cc1Cl |
| InChI | InChI=1S/C17H21Cl2NO2/c1-22-16-14(18)8-13(9-15(16)19)17(21)20-7-6-11-4-2-3-5-12(11)10-20/h8-9,11-12H,2-7,10H2,1H3/t11-,12-/m0/s1 |
| InChIKey | GFUVEGQUOIOYMD-RYUDHWBXSA-N |
| XLogP | 4.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |