C15H17Cl2NO4 — CID 51219311
methyl 1-(3,5-dichloro-4-methoxybenzoyl)piperidine-4-carboxylate (PubChem CID 51219311) has the molecular formula C15H17Cl2NO4 and a molecular weight of 346.21 g/mol. Its IUPAC name is methyl 1-(3,5-dichloro-4-methoxybenzoyl)piperidine-4-carboxylate.
| Compound Name | methyl 1-(3,5-dichloro-4-methoxybenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 51219311 |
| Molecular Formula | C15H17Cl2NO4 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | methyl 1-(3,5-dichloro-4-methoxybenzoyl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2cc(Cl)c(OC)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H17Cl2NO4/c1-21-13-11(16)7-10(8-12(13)17)14(19)18-5-3-9(4-6-18)15(20)22-2/h7-9H,3-6H2,1-2H3 |
| InChIKey | LTNGBQDHYUNVMC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |