C19H26BrNO3 — CID 25489180
[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-bromo-5-ethoxy-4-methoxyphenyl)methanone (PubChem CID 25489180) has the molecular formula C19H26BrNO3 and a molecular weight of 396.33 g/mol. Its IUPAC name is [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-bromo-5-ethoxy-4-methoxyphenyl)methanone.
| Compound Name | [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-bromo-5-ethoxy-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 25489180 |
| Molecular Formula | C19H26BrNO3 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-bromo-5-ethoxy-4-methoxyphenyl)methanone |
| SMILES | CCOc1cc(C(=O)N2CC[C@H]3CCCC[C@@H]3C2)cc(Br)c1OC |
| InChI | InChI=1S/C19H26BrNO3/c1-3-24-17-11-15(10-16(20)18(17)23-2)19(22)21-9-8-13-6-4-5-7-14(13)12-21/h10-11,13-14H,3-9,12H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | MQQCDZUDRPIIPE-ZIAGYGMSSA-N |
| XLogP | 4.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |