C15H20ClN3O — CID 82752372
2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-[5-chloro-6-(methylamino)-3-pyridinyl]methanone (PubChem CID 82752372) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-[5-chloro-6-(methylamino)-3-pyridinyl]methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-[5-chloro-6-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 82752372 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-[5-chloro-6-(methylamino)-3-pyridinyl]methanone |
| SMILES | CNc1ncc(C(=O)N2CCC3CCCCC32)cc1Cl |
| InChI | InChI=1S/C15H20ClN3O/c1-17-14-12(16)8-11(9-18-14)15(20)19-7-6-10-4-2-3-5-13(10)19/h8-10,13H,2-7H2,1H3,(H,17,18) |
| InChIKey | LWDKMYSHUVRDDO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |