C17H19BN2O3 — CID 174108509
[3-[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]quinolin-8-yl]boronic acid (PubChem CID 174108509) has the molecular formula C17H19BN2O3 and a molecular weight of 310.16 g/mol. Its IUPAC name is [3-[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]quinolin-8-yl]boronic acid.
| Compound Name | [3-[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]quinolin-8-yl]boronic acid |
|---|---|
| PubChem CID | 174108509 |
| Molecular Formula | C17H19BN2O3 |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [3-[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]quinolin-8-yl]boronic acid |
| SMILES | O=C(c1cnc2c(B(O)O)cccc2c1)N1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C17H19BN2O3/c21-17(20-9-12-4-1-5-13(12)10-20)14-7-11-3-2-6-15(18(22)23)16(11)19-8-14/h2-3,6-8,12-13,22-23H,1,4-5,9-10H2/t12-,13+ |
| InChIKey | MPWCTAUAFFIBCM-BETUJISGSA-N |
| XLogP | 0.79 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|