C16H17BN2O4 — CID 174108504
[3-(4-oxa-7-azaspiro[2.5]octane-7-carbonyl)quinolin-8-yl]boronic acid (PubChem CID 174108504) has the molecular formula C16H17BN2O4 and a molecular weight of 312.13 g/mol. Its IUPAC name is [3-(4-oxa-7-azaspiro[2.5]octane-7-carbonyl)quinolin-8-yl]boronic acid.
| Compound Name | [3-(4-oxa-7-azaspiro[2.5]octane-7-carbonyl)quinolin-8-yl]boronic acid |
|---|---|
| PubChem CID | 174108504 |
| Molecular Formula | C16H17BN2O4 |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [3-(4-oxa-7-azaspiro[2.5]octane-7-carbonyl)quinolin-8-yl]boronic acid |
| SMILES | O=C(c1cnc2c(B(O)O)cccc2c1)N1CCOC2(CC2)C1 |
| InChI | InChI=1S/C16H17BN2O4/c20-15(19-6-7-23-16(10-19)4-5-16)12-8-11-2-1-3-13(17(21)22)14(11)18-9-12/h1-3,8-9,21-22H,4-7,10H2 |
| InChIKey | IHNFPWNBQIVFIL-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|