C14H13BF2N2O3 — CID 174048232
[3-(3,3-difluoropyrrolidine-1-carbonyl)quinolin-8-yl]boronic acid (PubChem CID 174048232) has the molecular formula C14H13BF2N2O3 and a molecular weight of 306.08 g/mol. Its IUPAC name is [3-(3,3-difluoropyrrolidine-1-carbonyl)quinolin-8-yl]boronic acid.
| Compound Name | [3-(3,3-difluoropyrrolidine-1-carbonyl)quinolin-8-yl]boronic acid |
|---|---|
| PubChem CID | 174048232 |
| Molecular Formula | C14H13BF2N2O3 |
| Molecular Weight | 306.08 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [3-(3,3-difluoropyrrolidine-1-carbonyl)quinolin-8-yl]boronic acid |
| SMILES | O=C(c1cnc2c(B(O)O)cccc2c1)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C14H13BF2N2O3/c16-14(17)4-5-19(8-14)13(20)10-6-9-2-1-3-11(15(21)22)12(9)18-7-10/h1-3,6-7,21-22H,4-5,8H2 |
| InChIKey | VYMKWIDAQFJDLJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.08 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|