C17H14BrF2NO — CID 170459978
[3-(2-bromophenyl)phenyl]-(3,3-difluoropyrrolidin-1-yl)methanone (PubChem CID 170459978) has the molecular formula C17H14BrF2NO and a molecular weight of 366.21 g/mol. Its IUPAC name is [3-(2-bromophenyl)phenyl]-(3,3-difluoropyrrolidin-1-yl)methanone.
| Compound Name | [3-(2-bromophenyl)phenyl]-(3,3-difluoropyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 170459978 |
| Molecular Formula | C17H14BrF2NO |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | [3-(2-bromophenyl)phenyl]-(3,3-difluoropyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cccc(-c2ccccc2Br)c1)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C17H14BrF2NO/c18-15-7-2-1-6-14(15)12-4-3-5-13(10-12)16(22)21-9-8-17(19,20)11-21/h1-7,10H,8-9,11H2 |
| InChIKey | UVZWPDNVDODKEJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |