C19H17BrF3NO — CID 170459985
[3-(2-bromophenyl)phenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 170459985) has the molecular formula C19H17BrF3NO and a molecular weight of 412.25 g/mol. Its IUPAC name is [3-(2-bromophenyl)phenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | [3-(2-bromophenyl)phenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 170459985 |
| Molecular Formula | C19H17BrF3NO |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | [3-(2-bromophenyl)phenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cccc(-c2ccccc2Br)c1)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C19H17BrF3NO/c20-17-9-2-1-8-16(17)13-5-3-6-14(11-13)18(25)24-10-4-7-15(12-24)19(21,22)23/h1-3,5-6,8-9,11,15H,4,7,10,12H2 |
| InChIKey | OJIKZQDSRDNWIZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |