C14H12F6INO — CID 172647493
[3-iodo-4-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 172647493) has the molecular formula C14H12F6INO and a molecular weight of 451.15 g/mol. Its IUPAC name is [3-iodo-4-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | [3-iodo-4-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 172647493 |
| Molecular Formula | C14H12F6INO |
| Molecular Weight | 451.15 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | [3-iodo-4-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)c(I)c1)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H12F6INO/c15-13(16,17)9-2-1-5-22(7-9)12(23)8-3-4-10(11(21)6-8)14(18,19)20/h3-4,6,9H,1-2,5,7H2 |
| InChIKey | NUILRLMTJHKOAS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.15 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|