C19H21F3N2O — CID 46674111
[4-(2,5-dimethylpyrrol-1-yl)phenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 46674111) has the molecular formula C19H21F3N2O and a molecular weight of 350.38 g/mol. Its IUPAC name is [4-(2,5-dimethylpyrrol-1-yl)phenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | [4-(2,5-dimethylpyrrol-1-yl)phenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46674111 |
| Molecular Formula | C19H21F3N2O |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [4-(2,5-dimethylpyrrol-1-yl)phenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)N2CCCC(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C19H21F3N2O/c1-13-5-6-14(2)24(13)17-9-7-15(8-10-17)18(25)23-11-3-4-16(12-23)19(20,21)22/h5-10,16H,3-4,11-12H2,1-2H3 |
| InChIKey | YUDNSCCLRAGUSF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|