C17H23F3N2O3S — CID 41442273
N-[(2S)-butan-2-yl]-4-[(3R)-3-(trifluoromethyl)piperidine-1-carbonyl]benzenesulfonamide (PubChem CID 41442273) has the molecular formula C17H23F3N2O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-4-[(3R)-3-(trifluoromethyl)piperidine-1-carbonyl]benzenesulfonamide.
| Compound Name | N-[(2S)-butan-2-yl]-4-[(3R)-3-(trifluoromethyl)piperidine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41442273 |
| Molecular Formula | C17H23F3N2O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[(2S)-butan-2-yl]-4-[(3R)-3-(trifluoromethyl)piperidine-1-carbonyl]benzenesulfonamide |
| SMILES | CC[C@H](C)NS(=O)(=O)c1ccc(C(=O)N2CCC[C@@H](C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C17H23F3N2O3S/c1-3-12(2)21-26(24,25)15-8-6-13(7-9-15)16(23)22-10-4-5-14(11-22)17(18,19)20/h6-9,12,14,21H,3-5,10-11H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | HKSTZUPGOQATSV-GXTWGEPZSA-N |
| XLogP | 3.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |