C15H14F3NO — CID 170459096
(4-ethynylphenyl)-[3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 170459096) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is (4-ethynylphenyl)-[3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | (4-ethynylphenyl)-[3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 170459096 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (4-ethynylphenyl)-[3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | C#Cc1ccc(C(=O)N2CCCC(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C15H14F3NO/c1-2-11-5-7-12(8-6-11)14(20)19-9-3-4-13(10-19)15(16,17)18/h1,5-8,13H,3-4,9-10H2 |
| InChIKey | QXVKBGXFMPKKDD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|