C11H9Br2F2NO — CID 155289431
(3,5-dibromophenyl)-(3,3-difluoropyrrolidin-1-yl)methanone (PubChem CID 155289431) has the molecular formula C11H9Br2F2NO and a molecular weight of 369.00 g/mol. Its IUPAC name is (3,5-dibromophenyl)-(3,3-difluoropyrrolidin-1-yl)methanone.
| Compound Name | (3,5-dibromophenyl)-(3,3-difluoropyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 155289431 |
| Molecular Formula | C11H9Br2F2NO |
| Molecular Weight | 369.00 g/mol |
| Exact Mass | 366.90 |
| IUPAC Name | (3,5-dibromophenyl)-(3,3-difluoropyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cc(Br)cc(Br)c1)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C11H9Br2F2NO/c12-8-3-7(4-9(13)5-8)10(17)16-2-1-11(14,15)6-16/h3-5H,1-2,6H2 |
| InChIKey | VRHPDYILBGXVEA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.00 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |