C13H11Br2N3O3 — CID 103908737
7-(3,5-dibromobenzoyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 103908737) has the molecular formula C13H11Br2N3O3 and a molecular weight of 417.06 g/mol. Its IUPAC name is 7-(3,5-dibromobenzoyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-(3,5-dibromobenzoyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 103908737 |
| Molecular Formula | C13H11Br2N3O3 |
| Molecular Weight | 417.06 g/mol |
| Exact Mass | 414.92 |
| IUPAC Name | 7-(3,5-dibromobenzoyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)c3cc(Br)cc(Br)c3)C2)N1 |
| InChI | InChI=1S/C13H11Br2N3O3/c14-8-3-7(4-9(15)5-8)10(19)18-2-1-13(6-18)11(20)16-12(21)17-13/h3-5H,1-2,6H2,(H2,16,17,20,21) |
| InChIKey | YPWODPLUTTVIKD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.06 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|