C14H15N3O3 — CID 78996277
7-(3-methylbenzoyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 78996277) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 7-(3-methylbenzoyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-(3-methylbenzoyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 78996277 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 7-(3-methylbenzoyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | Cc1cccc(C(=O)N2CCC3(C2)NC(=O)NC3=O)c1 |
| InChI | InChI=1S/C14H15N3O3/c1-9-3-2-4-10(7-9)11(18)17-6-5-14(8-17)12(19)15-13(20)16-14/h2-4,7H,5-6,8H2,1H3,(H2,15,16,19,20) |
| InChIKey | OGFFQPYDPKOKMR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|