C21H19BrN4O4 — CID 71685247
3-bromo-N-[3-(2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbonyl)phenyl]benzamide (PubChem CID 71685247) has the molecular formula C21H19BrN4O4 and a molecular weight of 471.31 g/mol. Its IUPAC name is 3-bromo-N-[3-(2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbonyl)phenyl]benzamide.
| Compound Name | 3-bromo-N-[3-(2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 71685247 |
| Molecular Formula | C21H19BrN4O4 |
| Molecular Weight | 471.31 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 3-bromo-N-[3-(2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbonyl)phenyl]benzamide |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)c3cccc(NC(=O)c4cccc(Br)c4)c3)CC2)N1 |
| InChI | InChI=1S/C21H19BrN4O4/c22-15-5-1-3-13(11-15)17(27)23-16-6-2-4-14(12-16)18(28)26-9-7-21(8-10-26)19(29)24-20(30)25-21/h1-6,11-12H,7-10H2,(H,23,27)(H2,24,25,29,30) |
| InChIKey | JUNKOAUDZDWWPA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|