C11H11Cl2FN2O — CID 172648288
(2,5-dichloro-4-pyridinyl)-(4-fluoropiperidin-1-yl)methanone (PubChem CID 172648288) has the molecular formula C11H11Cl2FN2O and a molecular weight of 277.13 g/mol. Its IUPAC name is (2,5-dichloro-4-pyridinyl)-(4-fluoropiperidin-1-yl)methanone.
| Compound Name | (2,5-dichloro-4-pyridinyl)-(4-fluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 172648288 |
| Molecular Formula | C11H11Cl2FN2O |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | (2,5-dichloro-4-pyridinyl)-(4-fluoropiperidin-1-yl)methanone |
| SMILES | O=C(c1cc(Cl)ncc1Cl)N1CCC(F)CC1 |
| InChI | InChI=1S/C11H11Cl2FN2O/c12-9-6-15-10(13)5-8(9)11(17)16-3-1-7(14)2-4-16/h5-7H,1-4H2 |
| InChIKey | SCTITIAFENMZEG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|