C13H17ClN4O — CID 114923213
(2-amino-5-chloro-4-pyridinyl)-(4-cyclopropylpiperazin-1-yl)methanone (PubChem CID 114923213) has the molecular formula C13H17ClN4O and a molecular weight of 280.76 g/mol. Its IUPAC name is (2-amino-5-chloro-4-pyridinyl)-(4-cyclopropylpiperazin-1-yl)methanone.
| Compound Name | (2-amino-5-chloro-4-pyridinyl)-(4-cyclopropylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 114923213 |
| Molecular Formula | C13H17ClN4O |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (2-amino-5-chloro-4-pyridinyl)-(4-cyclopropylpiperazin-1-yl)methanone |
| SMILES | Nc1cc(C(=O)N2CCN(C3CC3)CC2)c(Cl)cn1 |
| InChI | InChI=1S/C13H17ClN4O/c14-11-8-16-12(15)7-10(11)13(19)18-5-3-17(4-6-18)9-1-2-9/h7-9H,1-6H2,(H2,15,16) |
| InChIKey | UDUBGTHMPCJUGG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |