C14H17Cl2N3O — CID 82833278
(4-amino-3,5-dichlorophenyl)-(4-cyclopropylpiperazin-1-yl)methanone (PubChem CID 82833278) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is (4-amino-3,5-dichlorophenyl)-(4-cyclopropylpiperazin-1-yl)methanone.
| Compound Name | (4-amino-3,5-dichlorophenyl)-(4-cyclopropylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 82833278 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (4-amino-3,5-dichlorophenyl)-(4-cyclopropylpiperazin-1-yl)methanone |
| SMILES | Nc1c(Cl)cc(C(=O)N2CCN(C3CC3)CC2)cc1Cl |
| InChI | InChI=1S/C14H17Cl2N3O/c15-11-7-9(8-12(16)13(11)17)14(20)19-5-3-18(4-6-19)10-1-2-10/h7-8,10H,1-6,17H2 |
| InChIKey | AICJSGKQPQCWAX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|