C14H18Cl2N2O — CID 82833580
(4-amino-3,5-dichlorophenyl)-(4,4-dimethylpiperidin-1-yl)methanone (PubChem CID 82833580) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is (4-amino-3,5-dichlorophenyl)-(4,4-dimethylpiperidin-1-yl)methanone.
| Compound Name | (4-amino-3,5-dichlorophenyl)-(4,4-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 82833580 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (4-amino-3,5-dichlorophenyl)-(4,4-dimethylpiperidin-1-yl)methanone |
| SMILES | CC1(C)CCN(C(=O)c2cc(Cl)c(N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H18Cl2N2O/c1-14(2)3-5-18(6-4-14)13(19)9-7-10(15)12(17)11(16)8-9/h7-8H,3-6,17H2,1-2H3 |
| InChIKey | YKQHSSQNQPPHLU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|