C15H20Cl2N2O2 — CID 102743680
(4-amino-3,5-dichlorophenyl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone (PubChem CID 102743680) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is (4-amino-3,5-dichlorophenyl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone.
| Compound Name | (4-amino-3,5-dichlorophenyl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 102743680 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (4-amino-3,5-dichlorophenyl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2cc(Cl)c(N)c(Cl)c2)CC(C)(C)O1 |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-14(2)7-19(8-15(3,4)21-14)13(20)9-5-10(16)12(18)11(17)6-9/h5-6H,7-8,18H2,1-4H3 |
| InChIKey | VUXGAHQTXWSFAU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|