C14H20ClN3O2 — CID 102737678
(2-amino-6-chloro-4-pyridinyl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone (PubChem CID 102737678) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is (2-amino-6-chloro-4-pyridinyl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone.
| Compound Name | (2-amino-6-chloro-4-pyridinyl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 102737678 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (2-amino-6-chloro-4-pyridinyl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2cc(N)nc(Cl)c2)CC(C)(C)O1 |
| InChI | InChI=1S/C14H20ClN3O2/c1-13(2)7-18(8-14(3,4)20-13)12(19)9-5-10(15)17-11(16)6-9/h5-6H,7-8H2,1-4H3,(H2,16,17) |
| InChIKey | BRIFHUGKEASYSQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|