C11H11ClN4O3 — CID 66074118
4-(2-amino-6-chloropyridine-4-carbonyl)-3-methylpiperazine-2,6-dione (PubChem CID 66074118) has the molecular formula C11H11ClN4O3 and a molecular weight of 282.69 g/mol. Its IUPAC name is 4-(2-amino-6-chloropyridine-4-carbonyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(2-amino-6-chloropyridine-4-carbonyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66074118 |
| Molecular Formula | C11H11ClN4O3 |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 4-(2-amino-6-chloropyridine-4-carbonyl)-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)c1cc(N)nc(Cl)c1 |
| InChI | InChI=1S/C11H11ClN4O3/c1-5-10(18)15-9(17)4-16(5)11(19)6-2-7(12)14-8(13)3-6/h2-3,5H,4H2,1H3,(H2,13,14)(H,15,17,18) |
| InChIKey | CXJHUNKXTOKIKL-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|