C10H10N4O3 — CID 102922193
3-methyl-4-(pyrimidine-5-carbonyl)piperazine-2,6-dione (PubChem CID 102922193) has the molecular formula C10H10N4O3 and a molecular weight of 234.21 g/mol. Its IUPAC name is 3-methyl-4-(pyrimidine-5-carbonyl)piperazine-2,6-dione.
| Compound Name | 3-methyl-4-(pyrimidine-5-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 102922193 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 3-methyl-4-(pyrimidine-5-carbonyl)piperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)c1cncnc1 |
| InChI | InChI=1S/C10H10N4O3/c1-6-9(16)13-8(15)4-14(6)10(17)7-2-11-5-12-3-7/h2-3,5-6H,4H2,1H3,(H,13,15,16) |
| InChIKey | XXFKJCCIKAEGHB-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|